C16H14F3NO4 — CID 118759406
2-[1-cyclopropyl-2,5-dioxo-3-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]acetic acid (PubChem CID 118759406) has the molecular formula C16H14F3NO4 and a molecular weight of 341.28 g/mol. Its IUPAC name is 2-[1-cyclopropyl-2,5-dioxo-3-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]acetic acid.
| Compound Name | 2-[1-cyclopropyl-2,5-dioxo-3-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 118759406 |
| Molecular Formula | C16H14F3NO4 |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 2-[1-cyclopropyl-2,5-dioxo-3-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1(c2cccc(C(F)(F)F)c2)CC(=O)N(C2CC2)C1=O |
| InChI | InChI=1S/C16H14F3NO4/c17-16(18,19)10-3-1-2-9(6-10)15(8-13(22)23)7-12(21)20(14(15)24)11-4-5-11/h1-3,6,11H,4-5,7-8H2,(H,22,23) |
| InChIKey | YXMHQMXQGPMYAT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|