About (7-pyrimidin-2-yl-1,2-dihydrobenzo[e][1]benzofuran-2-yl)methanamine
(7-pyrimidin-2-yl-1,2-dihydrobenzo[e][1]benzofuran-2-yl)methanamine (PubChem CID 118759553) has the molecular formula C17H15N3O
and a molecular weight of 277.33 g/mol. Its IUPAC name is (7-pyrimidin-2-yl-1,2-dihydrobenzo[e][1]benzofuran-2-yl)methanamine.
Molecular Properties
| Compound Name | (7-pyrimidin-2-yl-1,2-dihydrobenzo[e][1]benzofuran-2-yl)methanamine |
| PubChem CID | 118759553 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | (7-pyrimidin-2-yl-1,2-dihydrobenzo[e][1]benzofuran-2-yl)methanamine |
| SMILES | NCC1Cc2c(ccc3cc(-c4ncccn4)ccc23)O1 |
| InChI | InChI=1S/C17H15N3O/c18-10-13-9-15-14-4-2-12(17-19-6-1-7-20-17)8-11(14)3-5-16(15)21-13/h1-8,13H,9-10,18H2 |
| InChIKey | GPXIULSJSNTBHF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (7-pyrimidin-2-yl-1,2-dihydrobenzo[e][1]benzofuran-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-pyrimidin-2-yl-1,2-dihydrobenzo[e][1]benzofuran-2-yl)methanamine?
The IUPAC name of (7-pyrimidin-2-yl-1,2-dihydrobenzo[e][1]benzofuran-2-yl)methanamine (CID 118759553) is (7-pyrimidin-2-yl-1,2-dihydrobenzo[e][1]benzofuran-2-yl)methanamine.
What is the SMILES notation for (7-pyrimidin-2-yl-1,2-dihydrobenzo[e][1]benzofuran-2-yl)methanamine?
The canonical SMILES for (7-pyrimidin-2-yl-1,2-dihydrobenzo[e][1]benzofuran-2-yl)methanamine is NCC1Cc2c(ccc3cc(-c4ncccn4)ccc23)O1.
What is the InChIKey of (7-pyrimidin-2-yl-1,2-dihydrobenzo[e][1]benzofuran-2-yl)methanamine?
The InChIKey is GPXIULSJSNTBHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3O/c18-10-13-9-15-14-4-2-12(17-19-6-1-7-20-17)8-11(14)3-5-16(15)21-13/h1-8,13H,9-10,18H2.
What are the key properties of (7-pyrimidin-2-yl-1,2-dihydrobenzo[e][1]benzofuran-2-yl)methanamine?
(7-pyrimidin-2-yl-1,2-dihydrobenzo[e][1]benzofuran-2-yl)methanamine has a molecular weight of 277.33 g/mol, XLogP of 2.56, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-pyrimidin-2-yl-1,2-dihydrobenzo[e][1]benzofuran-2-yl)methanamine is sourced from PubChem (CID 118759553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).