About 2-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)pyrazol-1-yl]ethanol
2-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)pyrazol-1-yl]ethanol (PubChem CID 118760141) has the molecular formula C9H12N4OS
and a molecular weight of 224.29 g/mol. Its IUPAC name is 2-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)pyrazol-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)pyrazol-1-yl]ethanol |
| PubChem CID | 118760141 |
| Molecular Formula | C9H12N4OS |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 2-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)pyrazol-1-yl]ethanol |
| SMILES | Cc1nc(N)sc1-c1ccn(CCO)n1 |
| InChI | InChI=1S/C9H12N4OS/c1-6-8(15-9(10)11-6)7-2-3-13(12-7)4-5-14/h2-3,14H,4-5H2,1H3,(H2,10,11) |
| InChIKey | KYBOWBOGAGCWOF-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)pyrazol-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)pyrazol-1-yl]ethanol?
The IUPAC name of 2-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)pyrazol-1-yl]ethanol (CID 118760141) is 2-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)pyrazol-1-yl]ethanol.
What is the SMILES notation for 2-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)pyrazol-1-yl]ethanol?
The canonical SMILES for 2-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)pyrazol-1-yl]ethanol is Cc1nc(N)sc1-c1ccn(CCO)n1.
What is the InChIKey of 2-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)pyrazol-1-yl]ethanol?
The InChIKey is KYBOWBOGAGCWOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4OS/c1-6-8(15-9(10)11-6)7-2-3-13(12-7)4-5-14/h2-3,14H,4-5H2,1H3,(H2,10,11).
What are the key properties of 2-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)pyrazol-1-yl]ethanol?
2-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)pyrazol-1-yl]ethanol has a molecular weight of 224.29 g/mol, XLogP of 0.89, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)pyrazol-1-yl]ethanol is sourced from PubChem (CID 118760141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).