C17H22N2O5 — CID 118760256
2-[1-[2-(dimethylamino)ethyl]-3-(3-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]acetic acid (PubChem CID 118760256) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is 2-[1-[2-(dimethylamino)ethyl]-3-(3-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]acetic acid.
| Compound Name | 2-[1-[2-(dimethylamino)ethyl]-3-(3-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 118760256 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2-[1-[2-(dimethylamino)ethyl]-3-(3-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]acetic acid |
| SMILES | COc1cccc(C2(CC(=O)O)CC(=O)N(CCN(C)C)C2=O)c1 |
| InChI | InChI=1S/C17H22N2O5/c1-18(2)7-8-19-14(20)10-17(16(19)23,11-15(21)22)12-5-4-6-13(9-12)24-3/h4-6,9H,7-8,10-11H2,1-3H3,(H,21,22) |
| InChIKey | WTNNTPHWNOPJHR-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|