C17H24N4O4 — CID 118761133
(2-amino-4-methylpyrimidin-5-yl)-[(1S,2S,7S,10S)-1-hydroxy-4,12-dioxa-8-azatricyclo[8.4.0.02,7]tetradecan-8-yl]methanone (PubChem CID 118761133) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is (2-amino-4-methylpyrimidin-5-yl)-[(1S,2S,7S,10S)-1-hydroxy-4,12-dioxa-8-azatricyclo[8.4.0.02,7]tetradecan-8-yl]methanone.
| Compound Name | (2-amino-4-methylpyrimidin-5-yl)-[(1S,2S,7S,10S)-1-hydroxy-4,12-dioxa-8-azatricyclo[8.4.0.02,7]tetradecan-8-yl]methanone |
|---|---|
| PubChem CID | 118761133 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (2-amino-4-methylpyrimidin-5-yl)-[(1S,2S,7S,10S)-1-hydroxy-4,12-dioxa-8-azatricyclo[8.4.0.02,7]tetradecan-8-yl]methanone |
| SMILES | Cc1nc(N)ncc1C(=O)N1C[C@H]2COCC[C@@]2(O)[C@@H]2COCC[C@@H]21 |
| InChI | InChI=1S/C17H24N4O4/c1-10-12(6-19-16(18)20-10)15(22)21-7-11-8-25-5-3-17(11,23)13-9-24-4-2-14(13)21/h6,11,13-14,23H,2-5,7-9H2,1H3,(H2,18,19,20)/t11-,13+,14-,17-/m0/s1 |
| InChIKey | LWSVDPUCSCVCRG-SYEQVDHESA-N |
| XLogP | -0.00 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |