C18H24N4O2S — CID 118761331
[5-(imidazol-1-ylmethyl)furan-2-yl]-[4-(thian-4-yl)piperazin-1-yl]methanone (PubChem CID 118761331) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is [5-(imidazol-1-ylmethyl)furan-2-yl]-[4-(thian-4-yl)piperazin-1-yl]methanone.
| Compound Name | [5-(imidazol-1-ylmethyl)furan-2-yl]-[4-(thian-4-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 118761331 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | [5-(imidazol-1-ylmethyl)furan-2-yl]-[4-(thian-4-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(Cn2ccnc2)o1)N1CCN(C2CCSCC2)CC1 |
| InChI | InChI=1S/C18H24N4O2S/c23-18(17-2-1-16(24-17)13-20-6-5-19-14-20)22-9-7-21(8-10-22)15-3-11-25-12-4-15/h1-2,5-6,14-15H,3-4,7-13H2 |
| InChIKey | GVUDCFZWVKIMDD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 54.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |