C15H22N4O3S — CID 118761675
N-[2-(1-ethylbenzimidazol-2-yl)ethyl]-3-(methanesulfonamido)propanamide (PubChem CID 118761675) has the molecular formula C15H22N4O3S and a molecular weight of 338.43 g/mol. Its IUPAC name is N-[2-(1-ethylbenzimidazol-2-yl)ethyl]-3-(methanesulfonamido)propanamide.
| Compound Name | N-[2-(1-ethylbenzimidazol-2-yl)ethyl]-3-(methanesulfonamido)propanamide |
|---|---|
| PubChem CID | 118761675 |
| Molecular Formula | C15H22N4O3S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-[2-(1-ethylbenzimidazol-2-yl)ethyl]-3-(methanesulfonamido)propanamide |
| SMILES | CCn1c(CCNC(=O)CCNS(C)(=O)=O)nc2ccccc21 |
| InChI | InChI=1S/C15H22N4O3S/c1-3-19-13-7-5-4-6-12(13)18-14(19)8-10-16-15(20)9-11-17-23(2,21)22/h4-7,17H,3,8-11H2,1-2H3,(H,16,20) |
| InChIKey | LKKNHBVAXVGCCO-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |