C14H18F4N4O3 — CID 118761845
1-[(3R,4R)-3-hydroxy-4-(pyrimidin-2-ylamino)piperidin-1-yl]-2-(2,2,3,3-tetrafluoropropoxy)ethanone (PubChem CID 118761845) has the molecular formula C14H18F4N4O3 and a molecular weight of 366.32 g/mol. Its IUPAC name is 1-[(3R,4R)-3-hydroxy-4-(pyrimidin-2-ylamino)piperidin-1-yl]-2-(2,2,3,3-tetrafluoropropoxy)ethanone.
| Compound Name | 1-[(3R,4R)-3-hydroxy-4-(pyrimidin-2-ylamino)piperidin-1-yl]-2-(2,2,3,3-tetrafluoropropoxy)ethanone |
|---|---|
| PubChem CID | 118761845 |
| Molecular Formula | C14H18F4N4O3 |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 1-[(3R,4R)-3-hydroxy-4-(pyrimidin-2-ylamino)piperidin-1-yl]-2-(2,2,3,3-tetrafluoropropoxy)ethanone |
| SMILES | O=C(COCC(F)(F)C(F)F)N1CC[C@@H](Nc2ncccn2)[C@H](O)C1 |
| InChI | InChI=1S/C14H18F4N4O3/c15-12(16)14(17,18)8-25-7-11(24)22-5-2-9(10(23)6-22)21-13-19-3-1-4-20-13/h1,3-4,9-10,12,23H,2,5-8H2,(H,19,20,21)/t9-,10-/m1/s1 |
| InChIKey | BRBCUKKIQFHRDY-NXEZZACHSA-N |
| XLogP | 0.77 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|