C17H24N2O4 — CID 118761847
5-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-2-methyl-1H-pyridin-4-one (PubChem CID 118761847) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 5-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-2-methyl-1H-pyridin-4-one.
| Compound Name | 5-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-2-methyl-1H-pyridin-4-one |
|---|---|
| PubChem CID | 118761847 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 5-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-2-methyl-1H-pyridin-4-one |
| SMILES | CO[C@@H]1CC[C@@]2(OC)CCN(C(=O)c3c[nH]c(C)cc3=O)[C@H]2C1 |
| InChI | InChI=1S/C17H24N2O4/c1-11-8-14(20)13(10-18-11)16(21)19-7-6-17(23-3)5-4-12(22-2)9-15(17)19/h8,10,12,15H,4-7,9H2,1-3H3,(H,18,20)/t12-,15+,17-/m1/s1 |
| InChIKey | KZLGVIVZDBAWSJ-ISTRZQFTSA-N |
| XLogP | 1.48 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |