C19H28N2O4 — CID 118762295
3-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-1,4,6-trimethylpyridin-2-one (PubChem CID 118762295) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is 3-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-1,4,6-trimethylpyridin-2-one.
| Compound Name | 3-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-1,4,6-trimethylpyridin-2-one |
|---|---|
| PubChem CID | 118762295 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 3-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-1,4,6-trimethylpyridin-2-one |
| SMILES | CO[C@@H]1CC[C@@]2(OC)CCN(C(=O)c3c(C)cc(C)n(C)c3=O)[C@H]2C1 |
| InChI | InChI=1S/C19H28N2O4/c1-12-10-13(2)20(3)17(22)16(12)18(23)21-9-8-19(25-5)7-6-14(24-4)11-15(19)21/h10,14-15H,6-9,11H2,1-5H3/t14-,15+,19-/m1/s1 |
| InChIKey | BUDRCIPLVCCUQX-ZRGWGRIASA-N |
| XLogP | 1.80 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |