C19H23N5O3S — CID 118762959
6-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide (PubChem CID 118762959) has the molecular formula C19H23N5O3S and a molecular weight of 401.49 g/mol. Its IUPAC name is 6-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide.
| Compound Name | 6-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118762959 |
| Molecular Formula | C19H23N5O3S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 6-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide |
| SMILES | CCc1nc(CNC(=O)c2csc3c2CCN(Cc2c(C)noc2C)C3)no1 |
| InChI | InChI=1S/C19H23N5O3S/c1-4-18-21-17(23-27-18)7-20-19(25)15-10-28-16-9-24(6-5-13(15)16)8-14-11(2)22-26-12(14)3/h10H,4-9H2,1-3H3,(H,20,25) |
| InChIKey | DGIPDVUULBCNFW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 97.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |