C20H27N3O2 — CID 118762980
N-[2-(azepan-1-yl)-2-phenylethyl]-2-(3-methyl-1,2-oxazol-5-yl)acetamide (PubChem CID 118762980) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)-2-phenylethyl]-2-(3-methyl-1,2-oxazol-5-yl)acetamide.
| Compound Name | N-[2-(azepan-1-yl)-2-phenylethyl]-2-(3-methyl-1,2-oxazol-5-yl)acetamide |
|---|---|
| PubChem CID | 118762980 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | N-[2-(azepan-1-yl)-2-phenylethyl]-2-(3-methyl-1,2-oxazol-5-yl)acetamide |
| SMILES | Cc1cc(CC(=O)NCC(c2ccccc2)N2CCCCCC2)on1 |
| InChI | InChI=1S/C20H27N3O2/c1-16-13-18(25-22-16)14-20(24)21-15-19(17-9-5-4-6-10-17)23-11-7-2-3-8-12-23/h4-6,9-10,13,19H,2-3,7-8,11-12,14-15H2,1H3,(H,21,24) |
| InChIKey | ASAALQOMHCXQRJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |