C19H29N5O3 — CID 118763186
(1R,5S,6R,7S)-3-(2-aminoethyl)-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxamide (PubChem CID 118763186) has the molecular formula C19H29N5O3 and a molecular weight of 375.47 g/mol. Its IUPAC name is (1R,5S,6R,7S)-3-(2-aminoethyl)-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxamide.
| Compound Name | (1R,5S,6R,7S)-3-(2-aminoethyl)-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxamide |
|---|---|
| PubChem CID | 118763186 |
| Molecular Formula | C19H29N5O3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | (1R,5S,6R,7S)-3-(2-aminoethyl)-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxamide |
| SMILES | CCn1nc(C)c(CNC(=O)[C@H]2[C@@H]3CC[C@@]4(CN(CCN)C(=O)[C@@H]24)O3)c1C |
| InChI | InChI=1S/C19H29N5O3/c1-4-24-12(3)13(11(2)22-24)9-21-17(25)15-14-5-6-19(27-14)10-23(8-7-20)18(26)16(15)19/h14-16H,4-10,20H2,1-3H3,(H,21,25)/t14-,15-,16+,19-/m0/s1 |
| InChIKey | PCBHMKMMMZXMNY-GGXPGOJBSA-N |
| XLogP | 0.10 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |