C21H33ClO3 — CID 11876344
1-[(3R,5S,8R,9S,10S,13S,14S,16S,17R)-16-chloro-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 11876344) has the molecular formula C21H33ClO3 and a molecular weight of 368.95 g/mol. Its IUPAC name is 1-[(3R,5S,8R,9S,10S,13S,14S,16S,17R)-16-chloro-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(3R,5S,8R,9S,10S,13S,14S,16S,17R)-16-chloro-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 11876344 |
| Molecular Formula | C21H33ClO3 |
| Molecular Weight | 368.95 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 1-[(3R,5S,8R,9S,10S,13S,14S,16S,17R)-16-chloro-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC(=O)[C@@]1(O)[C@@H](Cl)C[C@H]2[C@@H]3CC[C@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C21H33ClO3/c1-12(23)21(25)18(22)11-17-15-5-4-13-10-14(24)6-8-19(13,2)16(15)7-9-20(17,21)3/h13-18,24-25H,4-11H2,1-3H3/t13-,14+,15+,16-,17-,18-,19-,20-,21+/m0/s1 |
| InChIKey | FCNFDODVDQKBAV-KWHHLLRUSA-N |
| XLogP | 3.93 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.95 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|