C14H23N3O2S — CID 118763842
2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-N-[3-(1,3-thiazol-2-yl)propyl]acetamide (PubChem CID 118763842) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-N-[3-(1,3-thiazol-2-yl)propyl]acetamide.
| Compound Name | 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-N-[3-(1,3-thiazol-2-yl)propyl]acetamide |
|---|---|
| PubChem CID | 118763842 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-N-[3-(1,3-thiazol-2-yl)propyl]acetamide |
| SMILES | C[C@@H]1CN(CC(=O)NCCCc2nccs2)C[C@H](C)O1 |
| InChI | InChI=1S/C14H23N3O2S/c1-11-8-17(9-12(2)19-11)10-13(18)15-5-3-4-14-16-6-7-20-14/h6-7,11-12H,3-5,8-10H2,1-2H3,(H,15,18)/t11-,12+ |
| InChIKey | AQPWRVMVFTYYIT-TXEJJXNPSA-N |
| XLogP | 1.30 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|