C21H19N3O4 — CID 11876440
(1R,3R,3aR,6aS)-5-benzyl-1-(hydroxymethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 11876440) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is (1R,3R,3aR,6aS)-5-benzyl-1-(hydroxymethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | (1R,3R,3aR,6aS)-5-benzyl-1-(hydroxymethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 11876440 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | (1R,3R,3aR,6aS)-5-benzyl-1-(hydroxymethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | O=C1[C@@H]2[C@H](CO)N[C@]3(C(=O)Nc4ccccc43)[C@@H]2C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H19N3O4/c25-11-15-16-17(19(27)24(18(16)26)10-12-6-2-1-3-7-12)21(23-15)13-8-4-5-9-14(13)22-20(21)28/h1-9,15-17,23,25H,10-11H2,(H,22,28)/t15-,16+,17-,21-/m0/s1 |
| InChIKey | HQQYQASDYPZIRL-DLRJPAPCSA-N |
| XLogP | 0.60 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|