C15H18N4O3S — CID 118764489
1-(3-methyl-1,1-dioxothiolan-3-yl)-3-[3-(1H-pyrazol-5-yl)phenyl]urea (PubChem CID 118764489) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-[3-(1H-pyrazol-5-yl)phenyl]urea.
| Compound Name | 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-[3-(1H-pyrazol-5-yl)phenyl]urea |
|---|---|
| PubChem CID | 118764489 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-[3-(1H-pyrazol-5-yl)phenyl]urea |
| SMILES | CC1(NC(=O)Nc2cccc(-c3ccn[nH]3)c2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H18N4O3S/c1-15(6-8-23(21,22)10-15)18-14(20)17-12-4-2-3-11(9-12)13-5-7-16-19-13/h2-5,7,9H,6,8,10H2,1H3,(H,16,19)(H2,17,18,20) |
| InChIKey | MKSKWDGIDRLRGS-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |