About 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-[3-(1H-pyrazol-5-yl)phenyl]urea
1-(3-methyl-1,1-dioxothiolan-3-yl)-3-[3-(1H-pyrazol-5-yl)phenyl]urea (PubChem CID 118764489) has the molecular formula C15H18N4O3S
and a molecular weight of 334.40 g/mol. Its IUPAC name is 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-[3-(1H-pyrazol-5-yl)phenyl]urea.
Molecular Properties
| Compound Name | 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-[3-(1H-pyrazol-5-yl)phenyl]urea |
| PubChem CID | 118764489 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-[3-(1H-pyrazol-5-yl)phenyl]urea |
| SMILES | CC1(NC(=O)Nc2cccc(-c3ccn[nH]3)c2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H18N4O3S/c1-15(6-8-23(21,22)10-15)18-14(20)17-12-4-2-3-11(9-12)13-5-7-16-19-13/h2-5,7,9H,6,8,10H2,1H3,(H,16,19)(H2,17,18,20) |
| InChIKey | MKSKWDGIDRLRGS-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-[3-(1H-pyrazol-5-yl)phenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-[3-(1H-pyrazol-5-yl)phenyl]urea?
The IUPAC name of 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-[3-(1H-pyrazol-5-yl)phenyl]urea (CID 118764489) is 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-[3-(1H-pyrazol-5-yl)phenyl]urea.
What is the SMILES notation for 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-[3-(1H-pyrazol-5-yl)phenyl]urea?
The canonical SMILES for 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-[3-(1H-pyrazol-5-yl)phenyl]urea is CC1(NC(=O)Nc2cccc(-c3ccn[nH]3)c2)CCS(=O)(=O)C1.
What is the InChIKey of 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-[3-(1H-pyrazol-5-yl)phenyl]urea?
The InChIKey is MKSKWDGIDRLRGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4O3S/c1-15(6-8-23(21,22)10-15)18-14(20)17-12-4-2-3-11(9-12)13-5-7-16-19-13/h2-5,7,9H,6,8,10H2,1H3,(H,16,19)(H2,17,18,20).
What are the key properties of 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-[3-(1H-pyrazol-5-yl)phenyl]urea?
1-(3-methyl-1,1-dioxothiolan-3-yl)-3-[3-(1H-pyrazol-5-yl)phenyl]urea has a molecular weight of 334.40 g/mol, XLogP of 1.78, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-[3-(1H-pyrazol-5-yl)phenyl]urea is sourced from PubChem (CID 118764489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).