C21H28N4O — CID 118764654
[3-(1,5-dimethyl-1,2,4-triazol-3-yl)phenyl]-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methanone (PubChem CID 118764654) has the molecular formula C21H28N4O and a molecular weight of 352.48 g/mol. Its IUPAC name is [3-(1,5-dimethyl-1,2,4-triazol-3-yl)phenyl]-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methanone.
| Compound Name | [3-(1,5-dimethyl-1,2,4-triazol-3-yl)phenyl]-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methanone |
|---|---|
| PubChem CID | 118764654 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | [3-(1,5-dimethyl-1,2,4-triazol-3-yl)phenyl]-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methanone |
| SMILES | Cc1nc(-c2cccc(C(=O)N3C[C@]4(C)C[C@H]3CC(C)(C)C4)c2)nn1C |
| InChI | InChI=1S/C21H28N4O/c1-14-22-18(23-24(14)5)15-7-6-8-16(9-15)19(26)25-13-21(4)11-17(25)10-20(2,3)12-21/h6-9,17H,10-13H2,1-5H3/t17-,21-/m1/s1 |
| InChIKey | KUEWVLQAWALJPE-DYESRHJHSA-N |
| XLogP | 3.83 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |