C15H26N4O2 — CID 118764692
(3aR,6S,7aS)-1-[(3-ethyl-1H-1,2,4-triazol-5-yl)methyl]-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indole (PubChem CID 118764692) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is (3aR,6S,7aS)-1-[(3-ethyl-1H-1,2,4-triazol-5-yl)methyl]-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indole.
| Compound Name | (3aR,6S,7aS)-1-[(3-ethyl-1H-1,2,4-triazol-5-yl)methyl]-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indole |
|---|---|
| PubChem CID | 118764692 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | (3aR,6S,7aS)-1-[(3-ethyl-1H-1,2,4-triazol-5-yl)methyl]-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indole |
| SMILES | CCc1n[nH]c(CN2CC[C@]3(OC)CC[C@H](OC)C[C@H]23)n1 |
| InChI | InChI=1S/C15H26N4O2/c1-4-13-16-14(18-17-13)10-19-8-7-15(21-3)6-5-11(20-2)9-12(15)19/h11-12H,4-10H2,1-3H3,(H,16,17,18)/t11-,12-,15+/m0/s1 |
| InChIKey | HDLLLVBUMQRPII-SLEUVZQESA-N |
| XLogP | 1.53 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |