C19H23N3O2S — CID 118764759
1-[2-methyl-4-(pyrrolidine-1-carbonyl)phenyl]-3-[(5-methylthiophen-2-yl)methyl]urea (PubChem CID 118764759) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is 1-[2-methyl-4-(pyrrolidine-1-carbonyl)phenyl]-3-[(5-methylthiophen-2-yl)methyl]urea.
| Compound Name | 1-[2-methyl-4-(pyrrolidine-1-carbonyl)phenyl]-3-[(5-methylthiophen-2-yl)methyl]urea |
|---|---|
| PubChem CID | 118764759 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 1-[2-methyl-4-(pyrrolidine-1-carbonyl)phenyl]-3-[(5-methylthiophen-2-yl)methyl]urea |
| SMILES | Cc1ccc(CNC(=O)Nc2ccc(C(=O)N3CCCC3)cc2C)s1 |
| InChI | InChI=1S/C19H23N3O2S/c1-13-11-15(18(23)22-9-3-4-10-22)6-8-17(13)21-19(24)20-12-16-7-5-14(2)25-16/h5-8,11H,3-4,9-10,12H2,1-2H3,(H2,20,21,24) |
| InChIKey | QFJBKGXKLUKENL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |