C20H28N4O3 — CID 118764876
N-[(3R,4R)-1-[2-(dimethylamino)-2-oxoethyl]-3-hydroxypiperidin-4-yl]-2-(2-methyl-1H-indol-3-yl)acetamide (PubChem CID 118764876) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-[(3R,4R)-1-[2-(dimethylamino)-2-oxoethyl]-3-hydroxypiperidin-4-yl]-2-(2-methyl-1H-indol-3-yl)acetamide.
| Compound Name | N-[(3R,4R)-1-[2-(dimethylamino)-2-oxoethyl]-3-hydroxypiperidin-4-yl]-2-(2-methyl-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 118764876 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | N-[(3R,4R)-1-[2-(dimethylamino)-2-oxoethyl]-3-hydroxypiperidin-4-yl]-2-(2-methyl-1H-indol-3-yl)acetamide |
| SMILES | Cc1[nH]c2ccccc2c1CC(=O)N[C@@H]1CCN(CC(=O)N(C)C)C[C@H]1O |
| InChI | InChI=1S/C20H28N4O3/c1-13-15(14-6-4-5-7-16(14)21-13)10-19(26)22-17-8-9-24(11-18(17)25)12-20(27)23(2)3/h4-7,17-18,21,25H,8-12H2,1-3H3,(H,22,26)/t17-,18-/m1/s1 |
| InChIKey | CYIJZFXEJPWKSZ-QZTJIDSGSA-N |
| XLogP | 0.66 |
| TPSA | 88.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|