C23H32NO+ — CID 11876586
(2S,3S,4R,6S)-2,6-diphenyl-3-propan-2-yl-4-propylpiperidin-1-ium-4-ol (PubChem CID 11876586) has the molecular formula C23H32NO+ and a molecular weight of 338.52 g/mol. Its IUPAC name is (2S,3S,4R,6S)-2,6-diphenyl-3-propan-2-yl-4-propylpiperidin-1-ium-4-ol.
| Compound Name | (2S,3S,4R,6S)-2,6-diphenyl-3-propan-2-yl-4-propylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 11876586 |
| Molecular Formula | C23H32NO+ |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | (2S,3S,4R,6S)-2,6-diphenyl-3-propan-2-yl-4-propylpiperidin-1-ium-4-ol |
| SMILES | CCC[C@@]1(O)C[C@@H](c2ccccc2)[NH2+][C@H](c2ccccc2)[C@@H]1C(C)C |
| InChI | InChI=1S/C23H31NO/c1-4-15-23(25)16-20(18-11-7-5-8-12-18)24-22(21(23)17(2)3)19-13-9-6-10-14-19/h5-14,17,20-22,24-25H,4,15-16H2,1-3H3/p+1/t20-,21-,22+,23+/m0/s1 |
| InChIKey | VKZWRJPZKYCXEQ-MYDTUXCISA-O |
| XLogP | 4.24 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |