C13H17N7O2S — CID 118765990
2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]ethanone (PubChem CID 118765990) has the molecular formula C13H17N7O2S and a molecular weight of 335.39 g/mol. Its IUPAC name is 2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]ethanone.
| Compound Name | 2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]ethanone |
|---|---|
| PubChem CID | 118765990 |
| Molecular Formula | C13H17N7O2S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]ethanone |
| SMILES | Cc1nc(SCC(=O)N2CC[C@H]3[C@H](C2)OCc2cnnn23)n[nH]1 |
| InChI | InChI=1S/C13H17N7O2S/c1-8-15-13(17-16-8)23-7-12(21)19-3-2-10-11(5-19)22-6-9-4-14-18-20(9)10/h4,10-11H,2-3,5-7H2,1H3,(H,15,16,17)/t10-,11-/m0/s1 |
| InChIKey | AXULDVXURCXPBV-QWRGUYRKSA-N |
| XLogP | 0.17 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |