C18H20N4O2 — CID 118767443
5-cyclopropyl-N-[3-(1-methylbenzimidazol-2-yl)propyl]-1,3-oxazole-4-carboxamide (PubChem CID 118767443) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 5-cyclopropyl-N-[3-(1-methylbenzimidazol-2-yl)propyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 5-cyclopropyl-N-[3-(1-methylbenzimidazol-2-yl)propyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 118767443 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 5-cyclopropyl-N-[3-(1-methylbenzimidazol-2-yl)propyl]-1,3-oxazole-4-carboxamide |
| SMILES | Cn1c(CCCNC(=O)c2ncoc2C2CC2)nc2ccccc21 |
| InChI | InChI=1S/C18H20N4O2/c1-22-14-6-3-2-5-13(14)21-15(22)7-4-10-19-18(23)16-17(12-8-9-12)24-11-20-16/h2-3,5-6,11-12H,4,7-10H2,1H3,(H,19,23) |
| InChIKey | HDUSNNNOBDDIKG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|