C22H24N4O — CID 118767826
[3-[3-[(1S,3S,8R)-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]-1,2,4-oxadiazol-5-yl]phenyl]methanamine (PubChem CID 118767826) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is [3-[3-[(1S,3S,8R)-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]-1,2,4-oxadiazol-5-yl]phenyl]methanamine.
| Compound Name | [3-[3-[(1S,3S,8R)-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]-1,2,4-oxadiazol-5-yl]phenyl]methanamine |
|---|---|
| PubChem CID | 118767826 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | [3-[3-[(1S,3S,8R)-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]-1,2,4-oxadiazol-5-yl]phenyl]methanamine |
| SMILES | NCc1cccc(-c2nc([C@H]3C[C@@H](c4ccccc4)N4CCC[C@H]34)no2)c1 |
| InChI | InChI=1S/C22H24N4O/c23-14-15-6-4-9-17(12-15)22-24-21(25-27-22)18-13-20(16-7-2-1-3-8-16)26-11-5-10-19(18)26/h1-4,6-9,12,18-20H,5,10-11,13-14,23H2/t18-,19+,20-/m0/s1 |
| InChIKey | ZVHDTVWHPDTELL-ZCNNSNEGSA-N |
| XLogP | 3.89 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |