C23H30FNO3 — CID 11876813
(1S,3R,4R,5S,8R,10R,14S)-5-[[2-(4-fluorophenyl)ethylamino]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one (PubChem CID 11876813) has the molecular formula C23H30FNO3 and a molecular weight of 387.50 g/mol. Its IUPAC name is (1S,3R,4R,5S,8R,10R,14S)-5-[[2-(4-fluorophenyl)ethylamino]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one.
| Compound Name | (1S,3R,4R,5S,8R,10R,14S)-5-[[2-(4-fluorophenyl)ethylamino]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one |
|---|---|
| PubChem CID | 11876813 |
| Molecular Formula | C23H30FNO3 |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | (1S,3R,4R,5S,8R,10R,14S)-5-[[2-(4-fluorophenyl)ethylamino]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one |
| SMILES | C[C@H]1CCC[C@]2(C)C[C@H]3OC(=O)[C@H](CNCCc4ccc(F)cc4)[C@H]3[C@H]3O[C@@]312 |
| InChI | InChI=1S/C23H30FNO3/c1-14-4-3-10-22(2)12-18-19(20-23(14,22)28-20)17(21(26)27-18)13-25-11-9-15-5-7-16(24)8-6-15/h5-8,14,17-20,25H,3-4,9-13H2,1-2H3/t14-,17+,18+,19+,20+,22+,23+/m0/s1 |
| InChIKey | DPJQDKPYAYDAMH-SKBCMGGYSA-N |
| XLogP | 3.48 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|