C16H19N3O2S — CID 118769258
2-morpholin-2-yl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]acetamide (PubChem CID 118769258) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is 2-morpholin-2-yl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]acetamide.
| Compound Name | 2-morpholin-2-yl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 118769258 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-morpholin-2-yl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]acetamide |
| SMILES | O=C(CC1CNCCO1)NCc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C16H19N3O2S/c20-15(8-13-9-17-6-7-21-13)18-10-16-19-14(11-22-16)12-4-2-1-3-5-12/h1-5,11,13,17H,6-10H2,(H,18,20) |
| InChIKey | BGVPWEWFRSMCAB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |