C17H28N4O2 — CID 118769485
3-cyclopropyl-N-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propyl]-5-methyl-1H-pyrazole-4-carboxamide (PubChem CID 118769485) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 3-cyclopropyl-N-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propyl]-5-methyl-1H-pyrazole-4-carboxamide.
| Compound Name | 3-cyclopropyl-N-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propyl]-5-methyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 118769485 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 3-cyclopropyl-N-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propyl]-5-methyl-1H-pyrazole-4-carboxamide |
| SMILES | Cc1[nH]nc(C2CC2)c1C(=O)NCCCN1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C17H28N4O2/c1-11-9-21(10-12(2)23-11)8-4-7-18-17(22)15-13(3)19-20-16(15)14-5-6-14/h11-12,14H,4-10H2,1-3H3,(H,18,22)(H,19,20)/t11-,12+ |
| InChIKey | OGSUFEAQGVLGBU-TXEJJXNPSA-N |
| XLogP | 1.82 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|