C14H20N2OS — CID 118769675
N-[(2E)-3,7-dimethylocta-2,6-dienyl]-1,3-thiazole-5-carboxamide (PubChem CID 118769675) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is N-[(2E)-3,7-dimethylocta-2,6-dienyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 118769675 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-1,3-thiazole-5-carboxamide |
| SMILES | CC(C)=CCC/C(C)=C/CNC(=O)c1cncs1 |
| InChI | InChI=1S/C14H20N2OS/c1-11(2)5-4-6-12(3)7-8-16-14(17)13-9-15-10-18-13/h5,7,9-10H,4,6,8H2,1-3H3,(H,16,17)/b12-7+ |
| InChIKey | BWQLSELJVBWHQC-KPKJPENVSA-N |
| XLogP | 3.57 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|