C16H25F2N3O — CID 118770128
1-(difluoromethyl)-N-[2-(1-ethylpiperidin-4-yl)ethyl]-5-methylpyrrole-2-carboxamide (PubChem CID 118770128) has the molecular formula C16H25F2N3O and a molecular weight of 313.39 g/mol. Its IUPAC name is 1-(difluoromethyl)-N-[2-(1-ethylpiperidin-4-yl)ethyl]-5-methylpyrrole-2-carboxamide.
| Compound Name | 1-(difluoromethyl)-N-[2-(1-ethylpiperidin-4-yl)ethyl]-5-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 118770128 |
| Molecular Formula | C16H25F2N3O |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 1-(difluoromethyl)-N-[2-(1-ethylpiperidin-4-yl)ethyl]-5-methylpyrrole-2-carboxamide |
| SMILES | CCN1CCC(CCNC(=O)c2ccc(C)n2C(F)F)CC1 |
| InChI | InChI=1S/C16H25F2N3O/c1-3-20-10-7-13(8-11-20)6-9-19-15(22)14-5-4-12(2)21(14)16(17)18/h4-5,13,16H,3,6-11H2,1-2H3,(H,19,22) |
| InChIKey | NRRYLDMJYOUQBO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |