C12H16F4N4O — CID 118770132
(1S,9R)-12-(3,3,4,4-tetrafluorobutyl)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene (PubChem CID 118770132) has the molecular formula C12H16F4N4O and a molecular weight of 308.28 g/mol. Its IUPAC name is (1S,9R)-12-(3,3,4,4-tetrafluorobutyl)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene.
| Compound Name | (1S,9R)-12-(3,3,4,4-tetrafluorobutyl)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene |
|---|---|
| PubChem CID | 118770132 |
| Molecular Formula | C12H16F4N4O |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (1S,9R)-12-(3,3,4,4-tetrafluorobutyl)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene |
| SMILES | FC(F)C(F)(F)CCN1CC[C@H]2OCc3cnnn3[C@H]2C1 |
| InChI | InChI=1S/C12H16F4N4O/c13-11(14)12(15,16)2-4-19-3-1-10-9(6-19)20-8(7-21-10)5-17-18-20/h5,9-11H,1-4,6-7H2/t9-,10+/m0/s1 |
| InChIKey | NPCJWUMWYYKQOT-VHSXEESVSA-N |
| XLogP | 1.71 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|