C19H21NO2 — CID 118770730
(3-hydroxyazetidin-1-yl)-[4-(4-propan-2-ylphenyl)phenyl]methanone (PubChem CID 118770730) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is (3-hydroxyazetidin-1-yl)-[4-(4-propan-2-ylphenyl)phenyl]methanone.
| Compound Name | (3-hydroxyazetidin-1-yl)-[4-(4-propan-2-ylphenyl)phenyl]methanone |
|---|---|
| PubChem CID | 118770730 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | (3-hydroxyazetidin-1-yl)-[4-(4-propan-2-ylphenyl)phenyl]methanone |
| SMILES | CC(C)c1ccc(-c2ccc(C(=O)N3CC(O)C3)cc2)cc1 |
| InChI | InChI=1S/C19H21NO2/c1-13(2)14-3-5-15(6-4-14)16-7-9-17(10-8-16)19(22)20-11-18(21)12-20/h3-10,13,18,21H,11-12H2,1-2H3 |
| InChIKey | YLNFOICAFICCRG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |