About beta-D-Glucuronate
beta-D-Glucuronate (PubChem CID 11877136) has the molecular formula C6H9O7-
and a molecular weight of 193.13 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate.
Molecular Properties
| Compound Name | beta-D-Glucuronate |
| PubChem CID | 11877136 |
| Molecular Formula | C6H9O7- |
| Molecular Weight | 193.13 g/mol |
| Exact Mass | 193.03 |
| IUPAC Name | (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate |
| SMILES | [C@@H]1([C@@H]([C@H](O[C@H]([C@@H]1O)O)C(=O)[O-])O)O |
| InChI | InChI=1S/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/p-1/t1-,2-,3+,4-,6+/m0/s1 |
| InChIKey | AEMOLEFTQBMNLQ-QIUUJYRFSA-M |
| XLogP | -1.70 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | 200 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.13 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze beta-D-Glucuronate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of beta-D-Glucuronate?
The IUPAC name of beta-D-Glucuronate (CID 11877136) is (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate.
What is the SMILES notation for beta-D-Glucuronate?
The canonical SMILES for beta-D-Glucuronate is [C@@H]1([C@@H]([C@H](O[C@H]([C@@H]1O)O)C(=O)[O-])O)O.
What is the InChIKey of beta-D-Glucuronate?
The InChIKey is AEMOLEFTQBMNLQ-QIUUJYRFSA-M. The full InChI is InChI=1S/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/p-1/t1-,2-,3+,4-,6+/m0/s1.
What are the key properties of beta-D-Glucuronate?
beta-D-Glucuronate has a molecular weight of 193.13 g/mol, XLogP of -1.70, 0 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for beta-D-Glucuronate is sourced from PubChem (CID 11877136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).