About (3S,4S)-4-[2-hydroxyethyl-[(4-propan-2-ylthiadiazol-5-yl)methyl]amino]-1,1-dioxothiolan-3-ol
(3S,4S)-4-[2-hydroxyethyl-[(4-propan-2-ylthiadiazol-5-yl)methyl]amino]-1,1-dioxothiolan-3-ol (PubChem CID 118772062) has the molecular formula C12H21N3O4S2
and a molecular weight of 335.45 g/mol. Its IUPAC name is (3S,4S)-4-[2-hydroxyethyl-[(4-propan-2-ylthiadiazol-5-yl)methyl]amino]-1,1-dioxothiolan-3-ol.
Molecular Properties
| Compound Name | (3S,4S)-4-[2-hydroxyethyl-[(4-propan-2-ylthiadiazol-5-yl)methyl]amino]-1,1-dioxothiolan-3-ol |
| PubChem CID | 118772062 |
| Molecular Formula | C12H21N3O4S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | (3S,4S)-4-[2-hydroxyethyl-[(4-propan-2-ylthiadiazol-5-yl)methyl]amino]-1,1-dioxothiolan-3-ol |
| SMILES | CC(C)c1nnsc1CN(CCO)[C@@H]1CS(=O)(=O)C[C@H]1O |
| InChI | InChI=1S/C12H21N3O4S2/c1-8(2)12-11(20-14-13-12)5-15(3-4-16)9-6-21(18,19)7-10(9)17/h8-10,16-17H,3-7H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | VHLZYLYDKBQURJ-NXEZZACHSA-N |
| XLogP | -0.39 |
| TPSA | 103.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (3S,4S)-4-[2-hydroxyethyl-[(4-propan-2-ylthiadiazol-5-yl)methyl]amino]-1,1-dioxothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-4-[2-hydroxyethyl-[(4-propan-2-ylthiadiazol-5-yl)methyl]amino]-1,1-dioxothiolan-3-ol?
The IUPAC name of (3S,4S)-4-[2-hydroxyethyl-[(4-propan-2-ylthiadiazol-5-yl)methyl]amino]-1,1-dioxothiolan-3-ol (CID 118772062) is (3S,4S)-4-[2-hydroxyethyl-[(4-propan-2-ylthiadiazol-5-yl)methyl]amino]-1,1-dioxothiolan-3-ol.
What is the SMILES notation for (3S,4S)-4-[2-hydroxyethyl-[(4-propan-2-ylthiadiazol-5-yl)methyl]amino]-1,1-dioxothiolan-3-ol?
The canonical SMILES for (3S,4S)-4-[2-hydroxyethyl-[(4-propan-2-ylthiadiazol-5-yl)methyl]amino]-1,1-dioxothiolan-3-ol is CC(C)c1nnsc1CN(CCO)[C@@H]1CS(=O)(=O)C[C@H]1O.
What is the InChIKey of (3S,4S)-4-[2-hydroxyethyl-[(4-propan-2-ylthiadiazol-5-yl)methyl]amino]-1,1-dioxothiolan-3-ol?
The InChIKey is VHLZYLYDKBQURJ-NXEZZACHSA-N. The full InChI is InChI=1S/C12H21N3O4S2/c1-8(2)12-11(20-14-13-12)5-15(3-4-16)9-6-21(18,19)7-10(9)17/h8-10,16-17H,3-7H2,1-2H3/t9-,10-/m1/s1.
What are the key properties of (3S,4S)-4-[2-hydroxyethyl-[(4-propan-2-ylthiadiazol-5-yl)methyl]amino]-1,1-dioxothiolan-3-ol?
(3S,4S)-4-[2-hydroxyethyl-[(4-propan-2-ylthiadiazol-5-yl)methyl]amino]-1,1-dioxothiolan-3-ol has a molecular weight of 335.45 g/mol, XLogP of -0.39, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-4-[2-hydroxyethyl-[(4-propan-2-ylthiadiazol-5-yl)methyl]amino]-1,1-dioxothiolan-3-ol is sourced from PubChem (CID 118772062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).