C15H18F4N2O2 — CID 118772090
N-[cyclopropyl-(6-methyl-2-pyridinyl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide (PubChem CID 118772090) has the molecular formula C15H18F4N2O2 and a molecular weight of 334.31 g/mol. Its IUPAC name is N-[cyclopropyl-(6-methyl-2-pyridinyl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide.
| Compound Name | N-[cyclopropyl-(6-methyl-2-pyridinyl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide |
|---|---|
| PubChem CID | 118772090 |
| Molecular Formula | C15H18F4N2O2 |
| Molecular Weight | 334.31 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | N-[cyclopropyl-(6-methyl-2-pyridinyl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide |
| SMILES | Cc1cccc(C(NC(=O)COCC(F)(F)C(F)F)C2CC2)n1 |
| InChI | InChI=1S/C15H18F4N2O2/c1-9-3-2-4-11(20-9)13(10-5-6-10)21-12(22)7-23-8-15(18,19)14(16)17/h2-4,10,13-14H,5-8H2,1H3,(H,21,22) |
| InChIKey | XFUFKEYBJLSGCM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|