About 1-(5-ethyl-2,4-dimethylpyrazol-3-yl)-3-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]urea
1-(5-ethyl-2,4-dimethylpyrazol-3-yl)-3-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]urea (PubChem CID 118772160) has the molecular formula C14H22N6OS
and a molecular weight of 322.44 g/mol. Its IUPAC name is 1-(5-ethyl-2,4-dimethylpyrazol-3-yl)-3-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]urea.
Molecular Properties
| Compound Name | 1-(5-ethyl-2,4-dimethylpyrazol-3-yl)-3-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]urea |
| PubChem CID | 118772160 |
| Molecular Formula | C14H22N6OS |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 1-(5-ethyl-2,4-dimethylpyrazol-3-yl)-3-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]urea |
| SMILES | CCc1nn(C)c(NC(=O)NCc2cnc(SC)n2C)c1C |
| InChI | InChI=1S/C14H22N6OS/c1-6-11-9(2)12(20(4)18-11)17-13(21)15-7-10-8-16-14(22-5)19(10)3/h8H,6-7H2,1-5H3,(H2,15,17,21) |
| InChIKey | CMQSKIFJKVKQRT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 76.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(5-ethyl-2,4-dimethylpyrazol-3-yl)-3-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-ethyl-2,4-dimethylpyrazol-3-yl)-3-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]urea?
The IUPAC name of 1-(5-ethyl-2,4-dimethylpyrazol-3-yl)-3-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]urea (CID 118772160) is 1-(5-ethyl-2,4-dimethylpyrazol-3-yl)-3-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]urea.
What is the SMILES notation for 1-(5-ethyl-2,4-dimethylpyrazol-3-yl)-3-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]urea?
The canonical SMILES for 1-(5-ethyl-2,4-dimethylpyrazol-3-yl)-3-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]urea is CCc1nn(C)c(NC(=O)NCc2cnc(SC)n2C)c1C.
What is the InChIKey of 1-(5-ethyl-2,4-dimethylpyrazol-3-yl)-3-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]urea?
The InChIKey is CMQSKIFJKVKQRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N6OS/c1-6-11-9(2)12(20(4)18-11)17-13(21)15-7-10-8-16-14(22-5)19(10)3/h8H,6-7H2,1-5H3,(H2,15,17,21).
What are the key properties of 1-(5-ethyl-2,4-dimethylpyrazol-3-yl)-3-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]urea?
1-(5-ethyl-2,4-dimethylpyrazol-3-yl)-3-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]urea has a molecular weight of 322.44 g/mol, XLogP of 2.07, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-ethyl-2,4-dimethylpyrazol-3-yl)-3-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]urea is sourced from PubChem (CID 118772160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).