About 4-[3-(3,6-dimethylpyrazin-2-yl)benzoyl]-3-methylpiperazin-2-one
4-[3-(3,6-dimethylpyrazin-2-yl)benzoyl]-3-methylpiperazin-2-one (PubChem CID 118772464) has the molecular formula C18H20N4O2
and a molecular weight of 324.38 g/mol. Its IUPAC name is 4-[3-(3,6-dimethylpyrazin-2-yl)benzoyl]-3-methylpiperazin-2-one.
Molecular Properties
| Compound Name | 4-[3-(3,6-dimethylpyrazin-2-yl)benzoyl]-3-methylpiperazin-2-one |
| PubChem CID | 118772464 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 4-[3-(3,6-dimethylpyrazin-2-yl)benzoyl]-3-methylpiperazin-2-one |
| SMILES | Cc1cnc(C)c(-c2cccc(C(=O)N3CCNC(=O)C3C)c2)n1 |
| InChI | InChI=1S/C18H20N4O2/c1-11-10-20-12(2)16(21-11)14-5-4-6-15(9-14)18(24)22-8-7-19-17(23)13(22)3/h4-6,9-10,13H,7-8H2,1-3H3,(H,19,23) |
| InChIKey | AVDLUHWDKKOUPG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[3-(3,6-dimethylpyrazin-2-yl)benzoyl]-3-methylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(3,6-dimethylpyrazin-2-yl)benzoyl]-3-methylpiperazin-2-one?
The IUPAC name of 4-[3-(3,6-dimethylpyrazin-2-yl)benzoyl]-3-methylpiperazin-2-one (CID 118772464) is 4-[3-(3,6-dimethylpyrazin-2-yl)benzoyl]-3-methylpiperazin-2-one.
What is the SMILES notation for 4-[3-(3,6-dimethylpyrazin-2-yl)benzoyl]-3-methylpiperazin-2-one?
The canonical SMILES for 4-[3-(3,6-dimethylpyrazin-2-yl)benzoyl]-3-methylpiperazin-2-one is Cc1cnc(C)c(-c2cccc(C(=O)N3CCNC(=O)C3C)c2)n1.
What is the InChIKey of 4-[3-(3,6-dimethylpyrazin-2-yl)benzoyl]-3-methylpiperazin-2-one?
The InChIKey is AVDLUHWDKKOUPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4O2/c1-11-10-20-12(2)16(21-11)14-5-4-6-15(9-14)18(24)22-8-7-19-17(23)13(22)3/h4-6,9-10,13H,7-8H2,1-3H3,(H,19,23).
What are the key properties of 4-[3-(3,6-dimethylpyrazin-2-yl)benzoyl]-3-methylpiperazin-2-one?
4-[3-(3,6-dimethylpyrazin-2-yl)benzoyl]-3-methylpiperazin-2-one has a molecular weight of 324.38 g/mol, XLogP of 1.72, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(3,6-dimethylpyrazin-2-yl)benzoyl]-3-methylpiperazin-2-one is sourced from PubChem (CID 118772464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).