C18H26N2O4 — CID 118772695
3-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-5,6-dimethyl-1H-pyridin-2-one (PubChem CID 118772695) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is 3-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-5,6-dimethyl-1H-pyridin-2-one.
| Compound Name | 3-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-5,6-dimethyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118772695 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 3-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-5,6-dimethyl-1H-pyridin-2-one |
| SMILES | CO[C@@H]1CC[C@@]2(OC)CCN(C(=O)c3cc(C)c(C)[nH]c3=O)[C@H]2C1 |
| InChI | InChI=1S/C18H26N2O4/c1-11-9-14(16(21)19-12(11)2)17(22)20-8-7-18(24-4)6-5-13(23-3)10-15(18)20/h9,13,15H,5-8,10H2,1-4H3,(H,19,21)/t13-,15+,18-/m1/s1 |
| InChIKey | JUZIABKBAPYYPW-QIIPPGSGSA-N |
| XLogP | 1.79 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |