C21H31N3O3 — CID 118772740
1-[[1-[3-(3-aminopropoxy)-4-methylbenzoyl]piperidin-3-yl]methyl]pyrrolidin-2-one (PubChem CID 118772740) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is 1-[[1-[3-(3-aminopropoxy)-4-methylbenzoyl]piperidin-3-yl]methyl]pyrrolidin-2-one.
| Compound Name | 1-[[1-[3-(3-aminopropoxy)-4-methylbenzoyl]piperidin-3-yl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 118772740 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 1-[[1-[3-(3-aminopropoxy)-4-methylbenzoyl]piperidin-3-yl]methyl]pyrrolidin-2-one |
| SMILES | Cc1ccc(C(=O)N2CCCC(CN3CCCC3=O)C2)cc1OCCCN |
| InChI | InChI=1S/C21H31N3O3/c1-16-7-8-18(13-19(16)27-12-4-9-22)21(26)24-11-2-5-17(15-24)14-23-10-3-6-20(23)25/h7-8,13,17H,2-6,9-12,14-15,22H2,1H3 |
| InChIKey | DZOFXLUDXZOXAK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|