C18H22FN5O — CID 118772799
5-fluoro-1,3-dimethyl-N-[1-(2-propyl-1,2,4-triazol-3-yl)ethyl]indole-2-carboxamide (PubChem CID 118772799) has the molecular formula C18H22FN5O and a molecular weight of 343.41 g/mol. Its IUPAC name is 5-fluoro-1,3-dimethyl-N-[1-(2-propyl-1,2,4-triazol-3-yl)ethyl]indole-2-carboxamide.
| Compound Name | 5-fluoro-1,3-dimethyl-N-[1-(2-propyl-1,2,4-triazol-3-yl)ethyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 118772799 |
| Molecular Formula | C18H22FN5O |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 5-fluoro-1,3-dimethyl-N-[1-(2-propyl-1,2,4-triazol-3-yl)ethyl]indole-2-carboxamide |
| SMILES | CCCn1ncnc1C(C)NC(=O)c1c(C)c2cc(F)ccc2n1C |
| InChI | InChI=1S/C18H22FN5O/c1-5-8-24-17(20-10-21-24)12(3)22-18(25)16-11(2)14-9-13(19)6-7-15(14)23(16)4/h6-7,9-10,12H,5,8H2,1-4H3,(H,22,25) |
| InChIKey | LBRJJMHKBSMNFN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|