C15H24N2O3 — CID 118773332
5-[[(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]methyl]-3-methyl-1,2-oxazole (PubChem CID 118773332) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 5-[[(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]methyl]-3-methyl-1,2-oxazole.
| Compound Name | 5-[[(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]methyl]-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 118773332 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 5-[[(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]methyl]-3-methyl-1,2-oxazole |
| SMILES | CO[C@H]1CC[C@@]2(OC)CCN(Cc3cc(C)no3)[C@H]2C1 |
| InChI | InChI=1S/C15H24N2O3/c1-11-8-13(20-16-11)10-17-7-6-15(19-3)5-4-12(18-2)9-14(15)17/h8,12,14H,4-7,9-10H2,1-3H3/t12-,14-,15+/m0/s1 |
| InChIKey | UQVAAUFDJGNJAB-AEGPPILISA-N |
| XLogP | 2.14 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |