C16H21F3N2O2 — CID 118773366
N-[2-(4-hydroxy-1-methylpiperidin-4-yl)ethyl]-2-(2,3,4-trifluorophenyl)acetamide (PubChem CID 118773366) has the molecular formula C16H21F3N2O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is N-[2-(4-hydroxy-1-methylpiperidin-4-yl)ethyl]-2-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | N-[2-(4-hydroxy-1-methylpiperidin-4-yl)ethyl]-2-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 118773366 |
| Molecular Formula | C16H21F3N2O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | N-[2-(4-hydroxy-1-methylpiperidin-4-yl)ethyl]-2-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CN1CCC(O)(CCNC(=O)Cc2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C16H21F3N2O2/c1-21-8-5-16(23,6-9-21)4-7-20-13(22)10-11-2-3-12(17)15(19)14(11)18/h2-3,23H,4-10H2,1H3,(H,20,22) |
| InChIKey | HTKRPBYZJDIUCQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|