About 2-cyclohexyl-1-[(3R,4R)-3-hydroxy-4-(pyrimidin-2-ylamino)piperidin-1-yl]ethanone
2-cyclohexyl-1-[(3R,4R)-3-hydroxy-4-(pyrimidin-2-ylamino)piperidin-1-yl]ethanone (PubChem CID 118773713) has the molecular formula C17H26N4O2
and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-cyclohexyl-1-[(3R,4R)-3-hydroxy-4-(pyrimidin-2-ylamino)piperidin-1-yl]ethanone.
Molecular Properties
| Compound Name | 2-cyclohexyl-1-[(3R,4R)-3-hydroxy-4-(pyrimidin-2-ylamino)piperidin-1-yl]ethanone |
| PubChem CID | 118773713 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 2-cyclohexyl-1-[(3R,4R)-3-hydroxy-4-(pyrimidin-2-ylamino)piperidin-1-yl]ethanone |
| SMILES | O=C(CC1CCCCC1)N1CC[C@@H](Nc2ncccn2)[C@H](O)C1 |
| InChI | InChI=1S/C17H26N4O2/c22-15-12-21(16(23)11-13-5-2-1-3-6-13)10-7-14(15)20-17-18-8-4-9-19-17/h4,8-9,13-15,22H,1-3,5-7,10-12H2,(H,18,19,20)/t14-,15-/m1/s1 |
| InChIKey | PJSDBKATVVFUKZ-HUUCEWRRSA-N |
| XLogP | 1.82 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyclohexyl-1-[(3R,4R)-3-hydroxy-4-(pyrimidin-2-ylamino)piperidin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-1-[(3R,4R)-3-hydroxy-4-(pyrimidin-2-ylamino)piperidin-1-yl]ethanone?
The IUPAC name of 2-cyclohexyl-1-[(3R,4R)-3-hydroxy-4-(pyrimidin-2-ylamino)piperidin-1-yl]ethanone (CID 118773713) is 2-cyclohexyl-1-[(3R,4R)-3-hydroxy-4-(pyrimidin-2-ylamino)piperidin-1-yl]ethanone.
What is the SMILES notation for 2-cyclohexyl-1-[(3R,4R)-3-hydroxy-4-(pyrimidin-2-ylamino)piperidin-1-yl]ethanone?
The canonical SMILES for 2-cyclohexyl-1-[(3R,4R)-3-hydroxy-4-(pyrimidin-2-ylamino)piperidin-1-yl]ethanone is O=C(CC1CCCCC1)N1CC[C@@H](Nc2ncccn2)[C@H](O)C1.
What is the InChIKey of 2-cyclohexyl-1-[(3R,4R)-3-hydroxy-4-(pyrimidin-2-ylamino)piperidin-1-yl]ethanone?
The InChIKey is PJSDBKATVVFUKZ-HUUCEWRRSA-N. The full InChI is InChI=1S/C17H26N4O2/c22-15-12-21(16(23)11-13-5-2-1-3-6-13)10-7-14(15)20-17-18-8-4-9-19-17/h4,8-9,13-15,22H,1-3,5-7,10-12H2,(H,18,19,20)/t14-,15-/m1/s1.
What are the key properties of 2-cyclohexyl-1-[(3R,4R)-3-hydroxy-4-(pyrimidin-2-ylamino)piperidin-1-yl]ethanone?
2-cyclohexyl-1-[(3R,4R)-3-hydroxy-4-(pyrimidin-2-ylamino)piperidin-1-yl]ethanone has a molecular weight of 318.42 g/mol, XLogP of 1.82, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-1-[(3R,4R)-3-hydroxy-4-(pyrimidin-2-ylamino)piperidin-1-yl]ethanone is sourced from PubChem (CID 118773713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).