C23H35N3O — CID 118773757
(1S,3S,8R)-N-[3-[cyclopentyl(methyl)amino]propyl]-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1-carboxamide (PubChem CID 118773757) has the molecular formula C23H35N3O and a molecular weight of 369.55 g/mol. Its IUPAC name is (1S,3S,8R)-N-[3-[cyclopentyl(methyl)amino]propyl]-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1-carboxamide.
| Compound Name | (1S,3S,8R)-N-[3-[cyclopentyl(methyl)amino]propyl]-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1-carboxamide |
|---|---|
| PubChem CID | 118773757 |
| Molecular Formula | C23H35N3O |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.28 |
| IUPAC Name | (1S,3S,8R)-N-[3-[cyclopentyl(methyl)amino]propyl]-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1-carboxamide |
| SMILES | CN(CCCNC(=O)[C@H]1C[C@@H](c2ccccc2)N2CCC[C@H]12)C1CCCC1 |
| InChI | InChI=1S/C23H35N3O/c1-25(19-11-5-6-12-19)15-8-14-24-23(27)20-17-22(18-9-3-2-4-10-18)26-16-7-13-21(20)26/h2-4,9-10,19-22H,5-8,11-17H2,1H3,(H,24,27)/t20-,21+,22-/m0/s1 |
| InChIKey | ITAFIYRPNKUJJZ-BDTNDASRSA-N |
| XLogP | 3.59 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|