C18H25ClN2O2 — CID 118774564
2-chloro-6-methyl-N-[1-(oxan-4-yl)piperidin-4-yl]benzamide (PubChem CID 118774564) has the molecular formula C18H25ClN2O2 and a molecular weight of 336.86 g/mol. Its IUPAC name is 2-chloro-6-methyl-N-[1-(oxan-4-yl)piperidin-4-yl]benzamide.
| Compound Name | 2-chloro-6-methyl-N-[1-(oxan-4-yl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 118774564 |
| Molecular Formula | C18H25ClN2O2 |
| Molecular Weight | 336.86 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 2-chloro-6-methyl-N-[1-(oxan-4-yl)piperidin-4-yl]benzamide |
| SMILES | Cc1cccc(Cl)c1C(=O)NC1CCN(C2CCOCC2)CC1 |
| InChI | InChI=1S/C18H25ClN2O2/c1-13-3-2-4-16(19)17(13)18(22)20-14-5-9-21(10-6-14)15-7-11-23-12-8-15/h2-4,14-15H,5-12H2,1H3,(H,20,22) |
| InChIKey | OTIRRGPDORPCFW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.86 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |