C13H11FNO3- — CID 11877569
(1R,2R,5S)-3-(4-fluorobenzoyl)-3-azabicyclo[3.1.0]hexane-2-carboxylate (PubChem CID 11877569) has the molecular formula C13H11FNO3- and a molecular weight of 248.23 g/mol. Its IUPAC name is (1R,2R,5S)-3-(4-fluorobenzoyl)-3-azabicyclo[3.1.0]hexane-2-carboxylate.
| Compound Name | (1R,2R,5S)-3-(4-fluorobenzoyl)-3-azabicyclo[3.1.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 11877569 |
| Molecular Formula | C13H11FNO3- |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | (1R,2R,5S)-3-(4-fluorobenzoyl)-3-azabicyclo[3.1.0]hexane-2-carboxylate |
| SMILES | O=C([O-])[C@H]1[C@@H]2C[C@@H]2CN1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H12FNO3/c14-9-3-1-7(2-4-9)12(16)15-6-8-5-10(8)11(15)13(17)18/h1-4,8,10-11H,5-6H2,(H,17,18)/p-1/t8-,10-,11-/m1/s1 |
| InChIKey | GDVQTWSMSQVCRX-FBIMIBRVSA-M |
| XLogP | 0.04 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |