C17H19N3O2 — CID 118775706
[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-(4-pyrimidin-5-ylphenyl)methanone (PubChem CID 118775706) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is [(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-(4-pyrimidin-5-ylphenyl)methanone.
| Compound Name | [(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-(4-pyrimidin-5-ylphenyl)methanone |
|---|---|
| PubChem CID | 118775706 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | [(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-(4-pyrimidin-5-ylphenyl)methanone |
| SMILES | COC[C@@H]1CCCN1C(=O)c1ccc(-c2cncnc2)cc1 |
| InChI | InChI=1S/C17H19N3O2/c1-22-11-16-3-2-8-20(16)17(21)14-6-4-13(5-7-14)15-9-18-12-19-10-15/h4-7,9-10,12,16H,2-3,8,11H2,1H3/t16-/m0/s1 |
| InChIKey | NGTFVEJWLCJBDG-INIZCTEOSA-N |
| XLogP | 2.39 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |