C16H28N4 — CID 118775991
N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-imidazol-1-yl-N-methylethanamine (PubChem CID 118775991) has the molecular formula C16H28N4 and a molecular weight of 276.43 g/mol. Its IUPAC name is N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-imidazol-1-yl-N-methylethanamine.
| Compound Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-imidazol-1-yl-N-methylethanamine |
|---|---|
| PubChem CID | 118775991 |
| Molecular Formula | C16H28N4 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-imidazol-1-yl-N-methylethanamine |
| SMILES | CN(CCn1ccnc1)C[C@@H]1CCCN2CCCC[C@H]12 |
| InChI | InChI=1S/C16H28N4/c1-18(11-12-19-10-7-17-14-19)13-15-5-4-9-20-8-3-2-6-16(15)20/h7,10,14-16H,2-6,8-9,11-13H2,1H3/t15-,16+/m0/s1 |
| InChIKey | QRFQFXVZQFIYJY-JKSUJKDBSA-N |
| XLogP | 2.08 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |