C20H26FN3O2 — CID 118776075
(3aR,6S,7aS)-1-[[5-(3-fluorophenyl)-1H-pyrazol-4-yl]methyl]-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indole (PubChem CID 118776075) has the molecular formula C20H26FN3O2 and a molecular weight of 359.44 g/mol. Its IUPAC name is (3aR,6S,7aS)-1-[[5-(3-fluorophenyl)-1H-pyrazol-4-yl]methyl]-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indole.
| Compound Name | (3aR,6S,7aS)-1-[[5-(3-fluorophenyl)-1H-pyrazol-4-yl]methyl]-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indole |
|---|---|
| PubChem CID | 118776075 |
| Molecular Formula | C20H26FN3O2 |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | (3aR,6S,7aS)-1-[[5-(3-fluorophenyl)-1H-pyrazol-4-yl]methyl]-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indole |
| SMILES | CO[C@H]1CC[C@@]2(OC)CCN(Cc3cn[nH]c3-c3cccc(F)c3)[C@H]2C1 |
| InChI | InChI=1S/C20H26FN3O2/c1-25-17-6-7-20(26-2)8-9-24(18(20)11-17)13-15-12-22-23-19(15)14-4-3-5-16(21)10-14/h3-5,10,12,17-18H,6-9,11,13H2,1-2H3,(H,22,23)/t17-,18-,20+/m0/s1 |
| InChIKey | XWJQAIKQFQBBCE-CMKODMSKSA-N |
| XLogP | 3.37 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |