C21H34N4O — CID 118776370
N-[(1-methyl-4-phenylpiperidin-4-yl)methyl]-3-(4-methylpiperazin-1-yl)propanamide (PubChem CID 118776370) has the molecular formula C21H34N4O and a molecular weight of 358.53 g/mol. Its IUPAC name is N-[(1-methyl-4-phenylpiperidin-4-yl)methyl]-3-(4-methylpiperazin-1-yl)propanamide.
| Compound Name | N-[(1-methyl-4-phenylpiperidin-4-yl)methyl]-3-(4-methylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 118776370 |
| Molecular Formula | C21H34N4O |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | N-[(1-methyl-4-phenylpiperidin-4-yl)methyl]-3-(4-methylpiperazin-1-yl)propanamide |
| SMILES | CN1CCN(CCC(=O)NCC2(c3ccccc3)CCN(C)CC2)CC1 |
| InChI | InChI=1S/C21H34N4O/c1-23-12-9-21(10-13-23,19-6-4-3-5-7-19)18-22-20(26)8-11-25-16-14-24(2)15-17-25/h3-7H,8-18H2,1-2H3,(H,22,26) |
| InChIKey | AGYZHGGXZAYNAB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |